Drugs present in MMsINC which are similar to the molecule MMscode: MMs00628857
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727509![]() | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.81 |
MMs01725063![]() | Clc1cc(ccc1)C(=O)C(NC(C)(C)C)C | 0.78 |
MMs01725157![]() | Clc1ccc(cc1)C1(CCC1)C([NH+](C)C)CC(C)C | 0.77 |
MMs01725545![]() | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.71 |
MMs01725163![]() | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.70 |
MMs01725427![]() | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.70 |
MMs01725433![]() | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.70 |
MMs01725794![]() | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.70 |
MMs01725515![]() | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.70 |