Drugs present in MMsINC which are similar to the molecule MMscode: MMs00605116
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725545![]() | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.80 |
MMs01724754![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.79 |
MMs01725427![]() | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.74 |
MMs01725110![]() | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.74 |
MMs01724773![]() | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.74 |
MMs01725515![]() | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.74 |
MMs01724755![]() | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.73 |
MMs01725848![]() | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.73 |
MMs01725406![]() | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.72 |
MMs01724744![]() | O=C(C(N(CC)CC)C)c1ccccc1 | 0.71 |
MMs01727470![]() | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.70 |
MMs01727472![]() | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.70 |
MMs01725817![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.70 |
MMs01724871![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.70 |