Drugs present in MMsINC which are similar to the molecule MMscode: MMs00580610
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725545 | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.75 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.74 |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.72 |
MMs01725092 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.71 |
MMs01725094 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.71 |