Drugs present in MMsINC which are similar to the molecule MMscode: MMs00567463
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724907 | Clc1cc2c(-n3c(CN=C2c2ccccc2F)c[nH+]c3C)cc1 | 0.83 |
MMs01724991 | [NH+](CCc1c2cc(ccc2[nH]c1)Cn1ncnc1)(C)C | 0.79 |
MMs01726741 | [n+]12c(n(N=Nn3c4[n+](cccc4)c(C)c3-c3ccccc3)c(-c3ccccc3)c1C)cccc2 | 0.76 |
MMs01726906 | O=C(NC1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)N(CC)CC | 0.75 |
MMs01726908 | O=C(NC1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)N(CC)CC | 0.75 |
MMs01724884 | Clc1cc2c(-n3c(nnc3)CN=C2c2ccccc2)cc1 | 0.72 |
MMs01725141 | O=C(N(CC)CC)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1 | 0.70 |
MMs01726917 | O=C(N(CC)CC)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1 | 0.70 |