Drugs present in MMsINC which are similar to the molecule MMscode: MMs00563867
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726915 | S1c2c(C(=O)c3c1cccc3)c(NCCN(CC)CC)ccc2C | 0.73 |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.72 |
MMs01724773 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.72 |
MMs01725110 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.72 |
MMs01724876 | O=C1N(c2c(N(c3c1cccc3)C)cccc2)CCN(C)C | 0.72 |
MMs01725237 | Clc1cccc(NC(=O)c2ccccc2)c1CN(CC(=O)N1CCOCC1)C | 0.71 |
MMs01725438 | [NH+](CCCN1c2c(cccc2)C(c2c1cccc2)(C)C)(C)C | 0.71 |
MMs01725163 | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.70 |
MMs01725247 | O(C(=O)C1(CCN(CC1)CCc1ccc(N)cc1)c1ccccc1)CC | 0.70 |
MMs01724998 | O=C(N)c1cc2c3CC(NC)CCc3[nH]c2cc1 | 0.70 |
MMs01725025 | O=C(N)c1cc2c3CC(NC)CCc3[nH]c2cc1 | 0.70 |
MMs01724788 | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.70 |
MMs01725632 | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.70 |