Drugs present in MMsINC which are similar to the molecule MMscode: MMs00556200
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727509 | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.80 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.75 |
MMs01725370 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.75 |
MMs01725593 | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.75 |
MMs01725592 | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.75 |
MMs01724773 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.72 |
MMs01725110 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.72 |
MMs01725221 | Clc1ccc(cc1)C(N1CCN(CC1)Cc1cc(ccc1)C)c1ccccc1 | 0.71 |
MMs01726924 | Clc1ccc(cc1)C(N1CCN(CC1)Cc1cc(ccc1)C)c1ccccc1 | 0.71 |
MMs01725336 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.70 |
MMs01724755 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.70 |
MMs01725288 | Clc1ccc(cc1)C1S(=O)(=O)CCC(=O)N1C | 0.70 |
MMs01724735 | Clc1ccc(cc1)C1S(=O)(=O)CCC(=O)N1C | 0.70 |