Drugs present in MMsINC which are similar to the molecule MMscode: MMs00551554
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724876 | O=C1N(c2c(N(c3c1cccc3)C)cccc2)CCN(C)C | 0.79 |
MMs01724833 | FCC1=Nc2c(cc(N)cc2)C(=O)N1c1ccccc1C | 0.78 |
MMs01725798 | O=C1N(NC(=O)C1CCCC)c1ccccc1 | 0.77 |
MMs01725672 | O=C1N(NC(=O)C1CCCC)c1ccccc1 | 0.77 |
MMs01725545 | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.74 |
MMs01724890 | O=C1N(N(C(=O)C1CC=C(C)C)c1ccccc1)c1ccccc1 | 0.74 |
MMs01725685 | OC(=O)C(CCCC)C(=O)N(Nc1ccccc1)c1ccccc1 | 0.74 |
MMs01725683 | OC(=O)C(CCCC)C(=O)N(Nc1ccccc1)c1ccccc1 | 0.74 |
MMs01725217 | Fc1ccc(cc1)C(=O)CCCN1CCC(N2c3c(NC2=O)cccc3)=CC1 | 0.73 |
MMs01725237 | Clc1cccc(NC(=O)c2ccccc2)c1CN(CC(=O)N1CCOCC1)C | 0.71 |
MMs01725677 | O=C(NNCCC(=O)NCc1ccccc1)c1ccncc1 | 0.70 |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.70 |
MMs01725110 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.70 |
MMs01724773 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.70 |