Drugs present in MMsINC which are similar to the molecule MMscode: MMs00542904
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725253![]() | Brc1cc(cc(Br)c1O)C(=O)c1c2c(oc1CC)cccc2 | 0.82 |
MMs01726688![]() | O(C(=O)c1ccccc1)c1cc2CCC3C4CCC(O)C4(CCC3c2cc1)C | 0.74 |
MMs01726690![]() | O(C(=O)c1ccccc1)c1cc2CCC3C4CCC(O)C4(CCC3c2cc1)C | 0.74 |
MMs01726691![]() | O(C(=O)c1ccccc1)c1cc2CCC3C4CCC(O)C4(CCC3c2cc1)C | 0.74 |
MMs01726689![]() | O(C(=O)c1ccccc1)c1cc2CCC3C4CCC(O)C4(CCC3c2cc1)C | 0.74 |
MMs01725135![]() | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.73 |
MMs01724757![]() | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.73 |