Drugs present in MMsINC which are similar to the molecule MMscode: MMs00534881
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725104 | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.73 |
MMs01725546 | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](C(C)C)(C(C)C)C)=O | 0.72 |
MMs01724855 | O1Cc2c(cccc2)\C(\c2c1cccc2)=C\CCN(C)C | 0.72 |
MMs01725169 | Clc1ccc(OC(C(=O)NC(=O)NCN2CCOCC2)(C)C)cc1 | 0.71 |
MMs01725753 | O(C)c1cc(ccc1)C1(O)CCCCC1CN(C)C | 0.70 |
MMs01724749 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.70 |