Drugs present in MMsINC which are similar to the molecule MMscode: MMs00532695
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724743 | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.82 |
MMs01725392 | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.82 |
MMs01726518 | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.82 |
MMs01726519 | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.82 |
MMs01725540 | O(C(=O)C(O)(C1CCCCC1)c1ccccc1)CC#CCN(CC)CC | 0.78 |
MMs01725542 | O(C(=O)C(O)(C1CCCCC1)c1ccccc1)CC#CCN(CC)CC | 0.78 |
MMs01725118 | O(C(=O)C(O)(c1ccccc1)c1ccccc1)CCN1CCCCC1 | 0.73 |
MMs01724770 | O(C(=O)C(O)(c1ccccc1)c1ccccc1)C1CCC[N+](C1)(C)C | 0.73 |