Drugs present in MMsINC which are similar to the molecule MMscode: MMs00528154
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724875 | Clc1cc2S(=O)(=O)NC(=Nc2cc1)C | 0.75 |
MMs01725953 | S(=O)(=O)(c1ccc(N)cc1S(=O)(=O)NC(=O)C)c1ccc(N)cc1 | 0.74 |
MMs01725334 | Clc1cc2N=CNS(=O)(=O)c2cc1S(=O)(=O)N | 0.73 |
MMs01725573 | Clc1cc2N=C(NS(=O)(=O)c2cc1S(=O)(=O)N)CSCc1ccccc1 | 0.71 |
MMs01724935 | S(=O)(=O)(N)c1ccc(N2S(=O)(=O)CCCC2)cc1 | 0.70 |