Drugs present in MMsINC which are similar to the molecule MMscode: MMs00526580
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727470![]() | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.72 |
MMs01727472![]() | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.72 |
MMs01727028![]() | OC1(CCC2C3C(=C4C(=CC(=O)CC4)CC3)C(CC12C)c1ccc(N(C)C)cc1)C#CC | 0.70 |
MMs01727029![]() | OC1(CCC2C3C(=C4C(=CC(=O)CC4)CC3)C(CC12C)c1ccc(N(C)C)cc1)C#CC | 0.70 |
MMs01727030![]() | OC1(CCC2C3C(=C4C(=CC(=O)CC4)CC3)C(CC12C)c1ccc(N(C)C)cc1)C#CC | 0.70 |