Drugs present in MMsINC which are similar to the molecule MMscode: MMs00516706
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726205 | S1C2N(C(=O)C2NC(=O)C(O)c2ccccc2)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.75 |
MMs01725475 | S1C2N(C(=O)C2NC(=O)C(O)c2ccccc2)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.75 |
MMs01726201 | S1C2N(C(=O)C2NC(=O)C(O)c2ccccc2)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.75 |
MMs01726203 | S1C2N(C(=O)C2NC(=O)C(O)c2ccccc2)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.75 |
MMs01726207 | S1C2N(C(=O)C2NC(=O)C(OC=O)c2ccccc2)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.72 |
MMs01726211 | S1C2N(C(=O)C2NC(=O)C(OC=O)c2ccccc2)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.72 |
MMs01726213 | S1C2N(C(=O)C2NC(=O)C(OC=O)c2ccccc2)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.72 |
MMs01726209 | S1C2N(C(=O)C2NC(=O)C(OC=O)c2ccccc2)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.72 |
MMs01725528 | OC(=O)C(N(Cc1ccc(cc1)-c1ccccc1-c1[nH]nnn1)C(=O)CCCC)C(C)C | 0.70 |
MMs01727481 | OC(=O)C(N(Cc1ccc(cc1)-c1ccccc1-c1[nH]nnn1)C(=O)CCCC)C(C)C | 0.70 |