Drugs present in MMsINC which are similar to the molecule MMscode: MMs00506371
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726786 | P(OC(OC(=O)CC)C(C)C)(=O)(CCCCc1ccccc1)CC(=O)N1CC(CC1C(O)=O)C1CCCCC1 | 0.71 |
MMs01726788 | P(OC(OC(=O)CC)C(C)C)(=O)(CCCCc1ccccc1)CC(=O)N1CC(CC1C(O)=O)C1CCCCC1 | 0.71 |
MMs01726790 | P(OC(OC(=O)CC)C(C)C)(=O)(CCCCc1ccccc1)CC(=O)N1CC(CC1C(O)=O)C1CCCCC1 | 0.71 |
MMs01726792 | P(OC(OC(=O)CC)C(C)C)(=O)(CCCCc1ccccc1)CC(=O)N1CC(CC1C(O)=O)C1CCCCC1 | 0.71 |
MMs01725161 | O1CCN(CC1)CC(C(C(=O)N1CCCC1)(c1ccccc1)c1ccccc1)C | 0.71 |
MMs01725769 | O1CCN(CC1)CCC1CN(CC)C(=O)C1(c1ccccc1)c1ccccc1 | 0.71 |