Drugs present in MMsINC which are similar to the molecule MMscode: MMs00500972
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724895 | Oc1cc(ccc1\C=C\c1ccc(cc1)C(N)=N)C(N)=N | 0.75 |
MMs01725668 | Oc1ccc(cc1)CC(N)C | 0.72 |
MMs01724882 | Oc1cc([N+](CC)(C)C)ccc1 | 0.71 |
MMs01725923 | Oc1ccc(N=Nc2cc(C(O)=O)c(O)cc2)cc1C(O)=O | 0.71 |
MMs01725409 | Oc1ccc(cc1C(CCN(C(C)C)C(C)C)c1ccccc1)C | 0.70 |