Drugs present in MMsINC which are similar to the molecule MMscode: MMs00499819
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724751 | O(C)c1cc(ccc1O)C(=O)N(CC)CC | 0.75 |
MMs01725280 | O(C(=O)C)C1CC2N(CC1C(=O)N(CC)CC)CCc1cc(OC)c(OC)cc12 | 0.72 |
MMs01726071 | O(C(=O)C)C1CC2N(CC1C(=O)N(CC)CC)CCc1cc(OC)c(OC)cc12 | 0.72 |
MMs01725619 | O(C(=O)C(C)C)c1cc(ccc1OC(=O)C(C)C)CCNC | 0.72 |
MMs01724973 | O(C(=O)N(CC)C)c1cc(ccc1)C(N(C)C)C | 0.72 |
MMs01725388 | O(C(=O)N(CC)C)c1cc(ccc1)C(N(C)C)C | 0.72 |