Drugs present in MMsINC which are similar to the molecule MMscode: MMs00495393
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725409![]() | Oc1ccc(cc1C(CCN(C(C)C)C(C)C)c1ccccc1)C | 0.75 |
MMs01724795![]() | Oc1cc2c(CC3N(CCC2(C)C3C)CC=C(C)C)cc1 | 0.73 |
MMs01725123![]() | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.73 |
MMs01726520![]() | Oc1cc2c(CC3N(CCC2(C)C3C)CC2CC2)cc1 | 0.73 |
MMs01724867![]() | Oc1cc2c(CC3N(CCC2(C)C3C)CC2CC2)cc1 | 0.73 |
MMs01726137![]() | OC12C3(CCCC1)CCN(C2Cc1c3cc(O)cc1)CC1CCC1 | 0.71 |
MMs01726477![]() | O(C(=O)C(O)(c1ccccc1)c1ccccc1)C1C2CC[N+](C1)(CC2)C | 0.71 |
MMs01725397![]() | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725399![]() | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725395![]() | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.71 |
MMs01725185![]() | Fc1ccc(cc1)C(=O)CCCN1CCC(O)(CC1)c1cc(ccc1)C(F)(F)F | 0.70 |