Drugs present in MMsINC which are similar to the molecule MMscode: MMs00489896
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726609 | Ic1c(C(O)=O)c(I)c(NC(=O)C)cc1NC(=O)C | 0.82 |
MMs01724841 | O(C(=O)C)c1ccccc1C(Oc1ccc(NC(=O)C)cc1)=O | 0.79 |
MMs01727015 | Ic1c(C(O)=O)c(I)c(NC(=O)C)c(I)c1N(C(=O)C)C | 0.76 |
MMs01726849 | Ic1c(CNC(=O)C)c(I)c(NC(=O)C)c(I)c1C(O)=O | 0.74 |
MMs01726878 | Ic1c(C(=O)NC)c(I)c(NC(=O)C)c(I)c1C(O)=O | 0.74 |
MMs01725923 | Oc1ccc(N=Nc2cc(C(O)=O)c(O)cc2)cc1C(O)=O | 0.73 |
MMs01726675 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.73 |
MMs01726677 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.73 |
MMs01727470 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.73 |
MMs01727472 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.73 |
MMs01725247 | O(C(=O)C1(CCN(CC1)CCc1ccc(N)cc1)c1ccccc1)CC | 0.71 |
MMs01725685 | OC(=O)C(CCCC)C(=O)N(Nc1ccccc1)c1ccccc1 | 0.70 |
MMs01725683 | OC(=O)C(CCCC)C(=O)N(Nc1ccccc1)c1ccccc1 | 0.70 |