Drugs present in MMsINC which are similar to the molecule MMscode: MMs00485102
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726808![]() | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.74 |
MMs01726810![]() | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.74 |
MMs01726812![]() | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.74 |
MMs01725629![]() | O=C1N(CCC1)C(CC)C(=O)N | 0.72 |
MMs01726902![]() | O=C1N(CCC1)C(CC)C(=O)N | 0.72 |