Drugs present in MMsINC which are similar to the molecule MMscode: MMs00483407
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725806 | O1C(CNC1=O)COc1ccccc1OC | 0.76 |
MMs01724772 | O1C(CNC1=O)COc1ccccc1OC | 0.76 |
MMs01725292 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.73 |
MMs01724749 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.73 |
MMs01725375 | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.71 |
MMs01724775 | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.71 |
MMs01725619 | O(C(=O)C(C)C)c1cc(ccc1OC(=O)C(C)C)CCNC | 0.71 |
MMs01726487 | Clc1ccc(OC(C(OCCCC(=O)N(C)C)=O)(C)C)cc1 | 0.70 |
MMs01725461 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.70 |
MMs01725463 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.70 |