Drugs present in MMsINC which are similar to the molecule MMscode: MMs00482897
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726673 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.72 |
MMs01725949 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.72 |
MMs01726669 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.72 |
MMs01726671 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.72 |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01725323 | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01725325 | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01725327 | O1CCNC(C)C1c1ccccc1 | 0.71 |