Drugs present in MMsINC which are similar to the molecule MMscode: MMs00482889
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725547 | O(C(Cc1ccccc1)(C(CN(C)C)C)c1ccccc1)C(=O)CC | 0.78 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.73 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.73 |
MMs01724737 | Clc1ccc(cc1)C(OCCN(C)C)(C)c1ccccc1 | 0.71 |
MMs01725786 | Clc1ccc(cc1)C(OCCN(C)C)(C)c1ccccc1 | 0.71 |