Drugs present in MMsINC which are similar to the molecule MMscode: MMs00480769
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724888 | O1C2(CCN(CC2)CCc2ccccc2)CNC1=O | 0.80 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.74 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.72 |
MMs01725370 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.72 |
MMs01727529 | [NH3+]C(Cc1ccccc1)C | 0.72 |
MMs01727527 | [NH3+]C(Cc1ccccc1)C | 0.72 |
MMs01725545 | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.71 |
MMs01727509 | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.70 |
MMs01724755 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.70 |
MMs01725336 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.70 |