Drugs present in MMsINC which are similar to the molecule MMscode: MMs00480102
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727136![]() | O(C(=O)c1cccnc1)CC(COC(=O)c1cccnc1)(COC(=O)c1cccnc1)COC(=O)c1cccnc1 | 0.72 |
MMs01724766![]() | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.71 |
MMs01725701![]() | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.71 |
MMs01724953![]() | OC(=O)C1CCn2c1ccc2C(=O)c1ccccc1 | 0.71 |
MMs01725010![]() | OC(=O)C1CCn2c1ccc2C(=O)c1ccccc1 | 0.71 |







