Drugs present in MMsINC which are similar to the molecule MMscode: MMs00477245
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724841![]() | O(C(=O)C)c1ccccc1C(Oc1ccc(NC(=O)C)cc1)=O | 0.75 |
MMs01727164![]() | O1C(C)(C)C(OC)C(OC(=O)N)C(O)C1Oc1ccc2c(OC(=O)C(NC(=O)c3cc(CC=C(C)C)c(O)cc3)=C2O)c1C | 0.71 |
MMs01727166![]() | O1C(C)(C)C(OC)C(OC(=O)N)C(O)C1Oc1ccc2c(OC(=O)C(NC(=O)c3cc(CC=C(C)C)c(O)cc3)=C2O)c1C | 0.71 |
MMs01727167![]() | O1C(C)(C)C(OC)C(OC(=O)N)C(O)C1Oc1ccc2c(OC(=O)C(NC(=O)c3cc(CC=C(C)C)c(O)cc3)=C2O)c1C | 0.71 |
MMs01727165![]() | O1C(C)(C)C(OC)C(OC(=O)N)C(O)C1Oc1ccc2c(OC(=O)C(NC(=O)c3cc(CC=C(C)C)c(O)cc3)=C2O)c1C | 0.71 |
MMs01726462![]() | Clc1cc(C(=O)NC2CCN(CC2OC)CCCOc2ccc(F)cc2)c(OC)cc1N | 0.71 |
MMs01725857![]() | Clc1cc(C(=O)NC2CCN(CC2OC)CCCOc2ccc(F)cc2)c(OC)cc1N | 0.71 |