Drugs present in MMsINC which are similar to the molecule MMscode: MMs00470173
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727279 | O1c2c(OC1)cc1c(c2)C(C(C(=O)NNCC)C(CO)C1O)c1cc(OC)c(OC)c(OC)c1 | 0.73 |
MMs01725671 | O1c2c(OC1)cc1c(c2)C(C(C(=O)NNCC)C(CO)C1O)c1cc(OC)c(OC)c(OC)c1 | 0.73 |
MMs01725768 | O1c2c(OC1)cc1c(c2)C(C(C(=O)NNCC)C(CO)C1O)c1cc(OC)c(OC)c(OC)c1 | 0.73 |
MMs01727278 | O1c2c(OC1)cc1c(c2)C(C(C(=O)NNCC)C(CO)C1O)c1cc(OC)c(OC)c(OC)c1 | 0.73 |
MMs01725587 | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](CC)(CC)C)=O | 0.72 |
MMs01724776 | O(C)c1cc2c(cc(cc2)C(C(C(O)=O)(C)C)CC)cc1 | 0.72 |
MMs01725340 | O(C)c1cc2c(cc(cc2)C(C(C(O)=O)(C)C)CC)cc1 | 0.72 |
MMs01725546 | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](C(C)C)(C(C)C)C)=O | 0.71 |