Drugs present in MMsINC which are similar to the molecule MMscode: MMs00463563
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724929![]() | O=C1N(C)C(=O)NC(=O)C1(CC)c1ccccc1 | 0.80 |
MMs01726926![]() | O=C1N(C)C(=O)NC(=O)C1(CC)c1ccccc1 | 0.80 |
MMs01724925![]() | O=C1NCNC(=O)C1(CC)c1ccccc1 | 0.79 |
MMs01724754![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.78 |
MMs01725370![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.78 |
MMs01725848![]() | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.75 |
MMs01725647![]() | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.75 |
MMs01727287![]() | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.72 |
MMs01725538![]() | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.72 |
MMs01725773![]() | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.72 |
MMs01725828![]() | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.72 |
MMs01725406![]() | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.71 |
MMs01725515![]() | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.70 |
MMs01724788![]() | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.70 |
MMs01725632![]() | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.70 |