Drugs present in MMsINC which are similar to the molecule MMscode: MMs00459131
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725395 | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.73 |
MMs01726742 | Clc1ccc(cc1)C(O)(CC(O)(C)C)C | 0.73 |
MMs01724759 | Clc1ccc(cc1)C(O)(CC(O)(C)C)C | 0.73 |
MMs01725386 | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01725387 | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01725397 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725399 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725087 | OC(CCN1CCCC1)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01724797 | Clc1ccc(cc1)C(O)(C(O)(C)C)C | 0.71 |
MMs01725805 | Clc1ccc(cc1)C(O)(C(O)(C)C)C | 0.71 |