Drugs present in MMsINC which are similar to the molecule MMscode: MMs00448211
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.78 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.78 |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.75 |
MMs01725399 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.73 |
MMs01725397 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.73 |
MMs01727169 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |
MMs01727173 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |
MMs01725130 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |
MMs01727171 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |
MMs01725395 | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.71 |
MMs01725049 | O(C(c1ccccc1)c1ccccc1)C1CCN(CC1)C | 0.71 |
MMs01725327 | O1CCNC(C)C1c1ccccc1 | 0.70 |
MMs01725323 | O1CCNC(C)C1c1ccccc1 | 0.70 |
MMs01725325 | O1CCNC(C)C1c1ccccc1 | 0.70 |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.70 |