Drugs present in MMsINC which are similar to the molecule MMscode: MMs00437305
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726207 | S1C2N(C(=O)C2NC(=O)C(OC=O)c2ccccc2)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.71 |
MMs01726209 | S1C2N(C(=O)C2NC(=O)C(OC=O)c2ccccc2)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.71 |
MMs01726211 | S1C2N(C(=O)C2NC(=O)C(OC=O)c2ccccc2)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.71 |
MMs01726213 | S1C2N(C(=O)C2NC(=O)C(OC=O)c2ccccc2)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.71 |
MMs01727071 | S(CC=1COC2N(C(=O)C2(OC)NC(=O)C(C(O)=O)c2ccc(O)cc2)C=1C(O)=O)c1nnnn1C | 0.71 |
MMs01727073 | S(CC=1COC2N(C(=O)C2(OC)NC(=O)C(C(O)=O)c2ccc(O)cc2)C=1C(O)=O)c1nnnn1C | 0.71 |
MMs01727075 | S(CC=1COC2N(C(=O)C2(OC)NC(=O)C(C(O)=O)c2ccc(O)cc2)C=1C(O)=O)c1nnnn1C | 0.71 |
MMs01727077 | S(CC=1COC2N(C(=O)C2(OC)NC(=O)C(C(O)=O)c2ccc(O)cc2)C=1C(O)=O)c1nnnn1C | 0.71 |