Drugs present in MMsINC which are similar to the molecule MMscode: MMs00427982
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725163 | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.76 |
MMs01725798 | O=C1N(NC(=O)C1CCCC)c1ccccc1 | 0.76 |
MMs01725165 | Clc1cc2N(c3c(Sc2cc1)cccc3)CCCN1CCC(CC1)C(=O)N | 0.72 |
MMs01726847 | Ic1c(N(C(=O)C)CC(C(O)=O)C)c(I)cc(I)c1N | 0.70 |
MMs01726848 | Ic1c(N(C(=O)C)CC(C(O)=O)C)c(I)cc(I)c1N | 0.70 |