Drugs present in MMsINC which are similar to the molecule MMscode: MMs00424892
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726669 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.72 |
MMs01725949 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.72 |
MMs01726671 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.72 |
MMs01726673 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.72 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.72 |
MMs01725370 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.72 |
MMs01725817 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.71 |
MMs01725309 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.71 |
MMs01724871 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.71 |