Drugs present in MMsINC which are similar to the molecule MMscode: MMs00423485
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725830![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.80 |
MMs01724830![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.80 |
MMs01725723![]() | O(CC(O)CNC(C)(C)C)c1ccc(NC(=O)N(CC)CC)cc1C(=O)C | 0.77 |
MMs01724733![]() | O(CC(O)CNC(C)(C)C)c1c2CCC(=O)Nc2ccc1 | 0.75 |
MMs01727043![]() | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.73 |
MMs01727045![]() | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.73 |
MMs01727047![]() | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.73 |
MMs01727049![]() | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.73 |
MMs01724784![]() | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.72 |
MMs01725143![]() | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.72 |
MMs01725048![]() | O(C(=O)NC)c1cc2c(N(C3N(CCC23C)C)C)cc1 | 0.71 |













