Drugs present in MMsINC which are similar to the molecule MMscode: MMs00410282
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725870 | O1c2c(cc3c(N(CC)C(=CC3=O)C(O)=O)c2CCC)C(=O)C=C1C(O)=O | 0.71 |
MMs01726675 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.70 |
MMs01726677 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.70 |
MMs01725895 | O(CC)c1cc(ccc1C(O)=O)CC(=O)NC(CC(C)C)c1ccccc1N1CCCCC1 | 0.70 |
MMs01727297 | O(CC)c1cc(ccc1C(O)=O)CC(=O)NC(CC(C)C)c1ccccc1N1CCCCC1 | 0.70 |
MMs01725202 | O1c2c(cccc2)C(O)=C(C(CC(=O)C)c2ccc([N+](=O)[O-])cc2)C1=O | 0.70 |
MMs01725192 | O1c2c(cccc2)C(O)=C(C(CC(=O)C)c2ccc([N+](=O)[O-])cc2)C1=O | 0.70 |