Drugs present in MMsINC which are similar to the molecule MMscode: MMs00410027
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724925 | O=C1NCNC(=O)C1(CC)c1ccccc1 | 0.71 |
MMs01725647 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.71 |
MMs01725848 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.71 |
MMs01724929 | O=C1N(C)C(=O)NC(=O)C1(CC)c1ccccc1 | 0.70 |
MMs01726926 | O=C1N(C)C(=O)NC(=O)C1(CC)c1ccccc1 | 0.70 |