Drugs present in MMsINC which are similar to the molecule MMscode: MMs00407819
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725440 | [N+]1(CCC(CC1)=C(c1ccccc1)c1ccccc1)(C)C | 0.77 |
MMs01725092 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.73 |
MMs01725094 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.73 |
MMs01725397 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01725399 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01724764 | OC(CN1CC[N+](CC1)(C)C)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725433 | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.71 |
MMs01725794 | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.71 |
MMs01725395 | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.71 |
MMs01724871 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.71 |
MMs01725817 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.71 |
MMs01725734 | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.70 |
MMs01725733 | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.70 |
MMs01725735 | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.70 |
MMs01725393 | [NH+]1(CCC(CC1)=C1c2c(C=Cc3c1cccc3)cccc2)C | 0.70 |
MMs01725547 | O(C(Cc1ccccc1)(C(CN(C)C)C)c1ccccc1)C(=O)CC | 0.70 |