Drugs present in MMsINC which are similar to the molecule MMscode: MMs00402557
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725039![]() | Oc1cc(ccc1O)CC(NN)(C(O)=O)C | 0.71 |
MMs01725041![]() | Oc1cc(ccc1O)CC(NN)(C(O)=O)C | 0.71 |
MMs01725671![]() | O1c2c(OC1)cc1c(c2)C(C(C(=O)NNCC)C(CO)C1O)c1cc(OC)c(OC)c(OC)c1 | 0.70 |
MMs01725768![]() | O1c2c(OC1)cc1c(c2)C(C(C(=O)NNCC)C(CO)C1O)c1cc(OC)c(OC)c(OC)c1 | 0.70 |
MMs01727278![]() | O1c2c(OC1)cc1c(c2)C(C(C(=O)NNCC)C(CO)C1O)c1cc(OC)c(OC)c(OC)c1 | 0.70 |
MMs01727279![]() | O1c2c(OC1)cc1c(c2)C(C(C(=O)NNCC)C(CO)C1O)c1cc(OC)c(OC)c(OC)c1 | 0.70 |