Drugs present in MMsINC which are similar to the molecule MMscode: MMs00381696
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725863 | n1cn(nc1)C(c1ccc(cc1)C#N)c1ccc(cc1)C#N | 0.74 |
MMs01724840 | n1cn(nc1)Cc1cc(cc(c1)C(C#N)(C)C)C(C#N)(C)C | 0.72 |
MMs01725725 | o1nc(nc1NCCN(CCCC)CCCC)-c1ccccc1 | 0.72 |
MMs01725561 | O=C1N(Cc2ccc(cc2)-c2ccccc2-c2[nH]nnn2)C(=NC12CCCC2)CCCC | 0.72 |
MMs01724911 | o1nc(nc1CCN(CC)CC)-c1ccccc1 | 0.71 |