Drugs present in MMsINC which are similar to the molecule MMscode: MMs00359963
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.80 |
MMs01725440 | [N+]1(CCC(CC1)=C(c1ccccc1)c1ccccc1)(C)C | 0.78 |
MMs01725794 | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.73 |
MMs01725433 | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.73 |
MMs01724845 | Brc1ccccc1C[N+](CC)(C)C | 0.73 |
MMs01725393 | [NH+]1(CCC(CC1)=C1c2c(C=Cc3c1cccc3)cccc2)C | 0.72 |
MMs01726106 | OC(CCN1CCCCC1)(C12CC(CC1)C=C2)c1ccccc1 | 0.70 |
MMs01726108 | OC(CCN1CCCCC1)(C12CC(CC1)C=C2)c1ccccc1 | 0.70 |