Drugs present in MMsINC which are similar to the molecule MMscode: MMs00352400
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725169 | Clc1ccc(OC(C(=O)NC(=O)NCN2CCOCC2)(C)C)cc1 | 0.86 |
MMs01724870 | Clc1cccc(Cl)c1OC(C)C=1NCCN=1 | 0.78 |
MMs01724989 | Clc1cccc(Cl)c1OC(C)C=1NCCN=1 | 0.78 |
MMs01726487 | Clc1ccc(OC(C(OCCCC(=O)N(C)C)=O)(C)C)cc1 | 0.74 |
MMs01724731 | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.74 |
MMs01724951 | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.74 |
MMs01726819 | Clc1ccc(cc1)C(Oc1ccc(cc1)C(F)(F)F)C(OCCNC(=O)C)=O | 0.73 |
MMs01726820 | Clc1ccc(cc1)C(Oc1ccc(cc1)C(F)(F)F)C(OCCNC(=O)C)=O | 0.73 |