Drugs present in MMsINC which are similar to the molecule MMscode: MMs00351678
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724825![]() | O(C)c1c(OC)cc(cc1OC)C(=O)NC1CCCNC1 | 0.76 |
MMs01725388![]() | O(C(=O)N(CC)C)c1cc(ccc1)C(N(C)C)C | 0.75 |
MMs01725187![]() | O(C)c1c(OC)cc(cc1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 | 0.74 |
MMs01724842![]() | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.73 |
MMs01727513![]() | O1c2cc3C([N+](CCc3cc2OC)(C)C)Cc2ccc(Oc3c4C([N+](CCc4cc(OC)c3OC)(C)C)Cc3cc1c(OC)cc3)cc2 | 0.73 |
MMs01727510![]() | O1c2cc3C([N+](CCc3cc2OC)(C)C)Cc2ccc(Oc3c4C([N+](CCc4cc(OC)c3OC)(C)C)Cc3cc1c(OC)cc3)cc2 | 0.73 |
MMs01727512![]() | O1c2cc3C([N+](CCc3cc2OC)(C)C)Cc2ccc(Oc3c4C([N+](CCc4cc(OC)c3OC)(C)C)Cc3cc1c(OC)cc3)cc2 | 0.73 |
MMs01727511![]() | O(C(=O)C(CO)c1ccccc1)C1CC2[N+](C(C1)CC2)(Cc1ccc(OCCCC)cc1)C | 0.72 |
MMs01724751![]() | O(C)c1cc(ccc1O)C(=O)N(CC)CC | 0.71 |
MMs01725143![]() | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.71 |
MMs01724784![]() | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.71 |
MMs01725753![]() | O(C)c1cc(ccc1)C1(O)CCCCC1CN(C)C | 0.70 |