Drugs present in MMsINC which are similar to the molecule MMscode: MMs00348957
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726844 | OC1Cc2c(cccc2)C1NC(=O)C(Cc1ccccc1)CC(O)CN1CCN(CC1C(=O)NC(C)(C)C)Cc1cccnc1 | 0.74 |
MMs01726842 | OC1Cc2c(cccc2)C1NC(=O)C(Cc1ccccc1)CC(O)CN1CCN(CC1C(=O)NC(C)(C)C)Cc1cccnc1 | 0.74 |
MMs01725609 | s1cccc1CC(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.71 |
MMs01725846 | s1cccc1CC(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.71 |
MMs01725844 | s1cccc1CC(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.71 |
MMs01725842 | s1cccc1CC(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.71 |
MMs01724945 | [NH+]1(CCCC1)C\C=C(/c1ccc(cc1)C)\c1ncccc1 | 0.71 |
MMs01727009 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.71 |
MMs01725678 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.71 |
MMs01727005 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.71 |
MMs01727007 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.71 |
MMs01726401 | S1C2N(C(=O)C2NC(=O)CSc2ccncc2)C(C(O)=O)=C(C1)COC(=O)C | 0.70 |
MMs01726395 | S1C2N(C(=O)C2NC(=O)CSc2ccncc2)C(C(O)=O)=C(C1)COC(=O)C | 0.70 |
MMs01726397 | S1C2N(C(=O)C2NC(=O)CSc2ccncc2)C(C(O)=O)=C(C1)COC(=O)C | 0.70 |
MMs01726399 | S1C2N(C(=O)C2NC(=O)CSc2ccncc2)C(C(O)=O)=C(C1)COC(=O)C | 0.70 |
MMs01726969 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)CC | 0.70 |
MMs01725098 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)CC | 0.70 |
MMs01725416 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)CC | 0.70 |
MMs01726967 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)CC | 0.70 |