Drugs present in MMsINC which are similar to the molecule MMscode: MMs00345907
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725848 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.77 |
MMs01724832 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1ccc(cc1)C(=O)C | 0.74 |
MMs01725515 | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.72 |
MMs01724871 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.72 |
MMs01725817 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.72 |