Drugs present in MMsINC which are similar to the molecule MMscode: MMs00328970
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724766 | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.75 |
MMs01725096 | Clc1ccc(cc1)C(=O)c1n(C)c(cc1C)CC(O)=O | 0.75 |
MMs01727057 | Clc1cc2nc(ccc2cc1)\C=C\c1cc(ccc1)C(SCC1(CC1)CC(O)=O)CCc1ccccc1C(O)(C)C | 0.73 |
MMs01727059 | Clc1cc2nc(ccc2cc1)\C=C\c1cc(ccc1)C(SCC1(CC1)CC(O)=O)CCc1ccccc1C(O)(C)C | 0.73 |
MMs01726858 | Ic1cc(I)c2c(nccc2)c1O | 0.72 |
MMs01724808 | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.70 |