Drugs present in MMsINC which are similar to the molecule MMscode: MMs00328754
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724827![]() | O=C1N(C)C(=O)N(c2ncn(c12)CC(O)CN(CCO)C)C | 0.76 |
MMs01725082![]() | O=C1N(C)C(=O)N(c2ncn(c12)CC(O)C)C | 0.76 |
MMs01725083![]() | O=C1N(C)C(=O)N(c2ncn(c12)CC(O)C)C | 0.76 |
MMs01724963![]() | O1CCOC1Cn1c2c(nc1)N(C)C(=O)N(C)C2=O | 0.72 |
MMs01725527![]() | O=C1NC(=Nc2n(cnc12)COCCOC(=O)C(N)C(C)C)N | 0.71 |
MMs01725696![]() | O=C1NC(=Nc2n(cnc12)COCCOC(=O)C(N)C(C)C)N | 0.71 |