Drugs present in MMsINC which are similar to the molecule MMscode: MMs00296308
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725803![]() | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.79 |
MMs01725406![]() | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.77 |
MMs01727509![]() | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.77 |
MMs01725536![]() | [NH2+](CCC=C1c2c(CCc3c1cccc3)cccc2)C | 0.73 |
MMs01724754![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.73 |
MMs01725390![]() | [NH+](CCC=C1c2c(CCc3c1cccc3)cccc2)(C)C | 0.72 |
MMs01725393![]() | [NH+]1(CCC(CC1)=C1c2c(C=Cc3c1cccc3)cccc2)C | 0.71 |
MMs01727464![]() | [S+]12C(C3N(Cc4ccccc4)C(=O)N(C3C1)Cc1ccccc1)CCC2 | 0.71 |
MMs01727465![]() | [S+]12C(C3N(Cc4ccccc4)C(=O)N(C3C1)Cc1ccccc1)CCC2 | 0.71 |
MMs01727466![]() | [S+]12C(C3N(Cc4ccccc4)C(=O)N(C3C1)Cc1ccccc1)CCC2 | 0.71 |
MMs01727467![]() | [S+]12C(C3N(Cc4ccccc4)C(=O)N(C3C1)Cc1ccccc1)CCC2 | 0.71 |
MMs01725427![]() | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.70 |