Drugs present in MMsINC which are similar to the molecule MMscode: MMs00294299
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727179![]() | Clc1cc2c(NC(=O)CN3CC(OC23c2ccccc2)C)cc1 | 0.73 |
MMs01727180![]() | Clc1cc2c(NC(=O)CN3CC(OC23c2ccccc2)C)cc1 | 0.73 |
MMs01725049![]() | O(C(c1ccccc1)c1ccccc1)C1CCN(CC1)C | 0.72 |
MMs01725438![]() | [NH+](CCCN1c2c(cccc2)C(c2c1cccc2)(C)C)(C)C | 0.71 |
MMs01724800![]() | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01724790![]() | OCc1cc2CCC(Nc2cc1[N+](=O)[O-])CNC(C)C | 0.71 |
MMs01724788![]() | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.71 |