Drugs present in MMsINC which are similar to the molecule MMscode: MMs00292269
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726858 | Ic1cc(I)c2c(nccc2)c1O | 0.77 |
MMs01725051 | O(CC(O)CNC(C)C)c1c2c([nH]cc2)ccc1 | 0.75 |
MMs01725053 | O(CC(O)CNC(C)C)c1c2c([nH]cc2)ccc1 | 0.75 |
MMs01724808 | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.74 |
MMs01724830 | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.71 |
MMs01725830 | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.71 |