Drugs present in MMsINC which are similar to the molecule MMscode: MMs00286392
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724790![]() | OCc1cc2CCC(Nc2cc1[N+](=O)[O-])CNC(C)C | 0.81 |
MMs01725073![]() | Clc1cc(cc(Cl)c1N)C(O)CNC(C)(C)C | 0.80 |
MMs01725075![]() | Clc1cc(cc(Cl)c1N)C(O)CNC(C)(C)C | 0.80 |
MMs01725130![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |
MMs01727169![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |
MMs01727171![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |
MMs01727173![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |