Drugs present in MMsINC which are similar to the molecule MMscode: MMs00281288
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725819![]() | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.74 |
MMs01724778![]() | S1c2c(N(c3c1cccc3)CC1CC[NH+](C1)C)cccc2 | 0.71 |
MMs01725059![]() | S1c2c(N(c3c1cccc3)CCCN(C)C)cc(cc2)C(=O)C | 0.71 |
MMs01724810![]() | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(cc2)C(=O)CC | 0.70 |
MMs01725183![]() | Clc1cc2N(CC(=O)N3CCN(CC3)CCO)C(Sc2cc1)=O | 0.70 |